C23H23FO6 — CID 138567382
[3-[2-fluoro-4-[4-(1-hydroxy-2-methylprop-2-enoxy)phenyl]phenoxy]-3-oxopropyl] 2-methylprop-2-enoate (PubChem CID 138567382) has the molecular formula C23H23FO6 and a molecular weight of 414.43 g/mol. Its IUPAC name is [3-[2-fluoro-4-[4-(1-hydroxy-2-methylprop-2-enoxy)phenyl]phenoxy]-3-oxopropyl] 2-methylprop-2-enoate.
| Compound Name | [3-[2-fluoro-4-[4-(1-hydroxy-2-methylprop-2-enoxy)phenyl]phenoxy]-3-oxopropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 138567382 |
| Molecular Formula | C23H23FO6 |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | [3-[2-fluoro-4-[4-(1-hydroxy-2-methylprop-2-enoxy)phenyl]phenoxy]-3-oxopropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(=O)Oc1ccc(-c2ccc(OC(O)C(=C)C)cc2)cc1F |
| InChI | InChI=1S/C23H23FO6/c1-14(2)22(26)28-12-11-21(25)30-20-10-7-17(13-19(20)24)16-5-8-18(9-6-16)29-23(27)15(3)4/h5-10,13,23,27H,1,3,11-12H2,2,4H3 |
| InChIKey | ZNGJABMMNMAHEU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|