C29H32F2O6 — CID 138664459
[2-fluoro-4-[3-fluoro-4-[3-(2-methylprop-2-enoyloxy)-2-(2-methylprop-2-enoyloxymethyl)propyl]phenyl]phenyl] 2,2-dimethylpropanoate (PubChem CID 138664459) has the molecular formula C29H32F2O6 and a molecular weight of 514.57 g/mol. Its IUPAC name is [2-fluoro-4-[3-fluoro-4-[3-(2-methylprop-2-enoyloxy)-2-(2-methylprop-2-enoyloxymethyl)propyl]phenyl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [2-fluoro-4-[3-fluoro-4-[3-(2-methylprop-2-enoyloxy)-2-(2-methylprop-2-enoyloxymethyl)propyl]phenyl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 138664459 |
| Molecular Formula | C29H32F2O6 |
| Molecular Weight | 514.57 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | [2-fluoro-4-[3-fluoro-4-[3-(2-methylprop-2-enoyloxy)-2-(2-methylprop-2-enoyloxymethyl)propyl]phenyl]phenyl] 2,2-dimethylpropanoate |
| SMILES | C=C(C)C(=O)OCC(COC(=O)C(=C)C)Cc1ccc(-c2ccc(OC(=O)C(C)(C)C)c(F)c2)cc1F |
| InChI | InChI=1S/C29H32F2O6/c1-17(2)26(32)35-15-19(16-36-27(33)18(3)4)12-22-9-8-20(13-23(22)30)21-10-11-25(24(31)14-21)37-28(34)29(5,6)7/h8-11,13-14,19H,1,3,12,15-16H2,2,4-7H3 |
| InChIKey | OIMLPAGIVOUGOV-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.57 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|