C25H29FO5 — CID 166919626
[2-fluoro-4-[4-[2-hydroxy-2-methyl-1-(2-methylprop-2-enoyloxy)propyl]phenyl]phenyl] 2,2-dimethylpropanoate (PubChem CID 166919626) has the molecular formula C25H29FO5 and a molecular weight of 428.50 g/mol. Its IUPAC name is [2-fluoro-4-[4-[2-hydroxy-2-methyl-1-(2-methylprop-2-enoyloxy)propyl]phenyl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [2-fluoro-4-[4-[2-hydroxy-2-methyl-1-(2-methylprop-2-enoyloxy)propyl]phenyl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 166919626 |
| Molecular Formula | C25H29FO5 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | [2-fluoro-4-[4-[2-hydroxy-2-methyl-1-(2-methylprop-2-enoyloxy)propyl]phenyl]phenyl] 2,2-dimethylpropanoate |
| SMILES | C=C(C)C(=O)OC(c1ccc(-c2ccc(OC(=O)C(C)(C)C)c(F)c2)cc1)C(C)(C)O |
| InChI | InChI=1S/C25H29FO5/c1-15(2)22(27)31-21(25(6,7)29)17-10-8-16(9-11-17)18-12-13-20(19(26)14-18)30-23(28)24(3,4)5/h8-14,21,29H,1H2,2-7H3 |
| InChIKey | DNUFGQZYBZGXKQ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|