C23H25FO5 — CID 170106179
[4-[2-ethoxy-4-(2-methylprop-2-enoyloxy)phenyl]-2-fluorophenyl] 2,2-dimethylpropanoate (PubChem CID 170106179) has the molecular formula C23H25FO5 and a molecular weight of 400.45 g/mol. Its IUPAC name is [4-[2-ethoxy-4-(2-methylprop-2-enoyloxy)phenyl]-2-fluorophenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-[2-ethoxy-4-(2-methylprop-2-enoyloxy)phenyl]-2-fluorophenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 170106179 |
| Molecular Formula | C23H25FO5 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | [4-[2-ethoxy-4-(2-methylprop-2-enoyloxy)phenyl]-2-fluorophenyl] 2,2-dimethylpropanoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(OC(=O)C(C)(C)C)c(F)c2)c(OCC)c1 |
| InChI | InChI=1S/C23H25FO5/c1-7-27-20-13-16(28-21(25)14(2)3)9-10-17(20)15-8-11-19(18(24)12-15)29-22(26)23(4,5)6/h8-13H,2,7H2,1,3-6H3 |
| InChIKey | KHFNNMKYVIROQD-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|