C23H26O4 — CID 146641107
[4-[2-ethyl-4-(2-methylprop-2-enoyloxy)phenyl]phenyl] 2,2-dimethylpropanoate (PubChem CID 146641107) has the molecular formula C23H26O4 and a molecular weight of 366.46 g/mol. Its IUPAC name is [4-[2-ethyl-4-(2-methylprop-2-enoyloxy)phenyl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-[2-ethyl-4-(2-methylprop-2-enoyloxy)phenyl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 146641107 |
| Molecular Formula | C23H26O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | [4-[2-ethyl-4-(2-methylprop-2-enoyloxy)phenyl]phenyl] 2,2-dimethylpropanoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(OC(=O)C(C)(C)C)cc2)c(CC)c1 |
| InChI | InChI=1S/C23H26O4/c1-7-16-14-19(26-21(24)15(2)3)12-13-20(16)17-8-10-18(11-9-17)27-22(25)23(4,5)6/h8-14H,2,7H2,1,3-6H3 |
| InChIKey | AAPDBDBIDYVBRL-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|