C21H19FO4S — CID 160908180
[4-[3-fluoro-4-(2-methylprop-2-enoyloxy)phenyl]-3-methylsulfanylphenyl] 2-methylprop-2-enoate (PubChem CID 160908180) has the molecular formula C21H19FO4S and a molecular weight of 386.44 g/mol. Its IUPAC name is [4-[3-fluoro-4-(2-methylprop-2-enoyloxy)phenyl]-3-methylsulfanylphenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[3-fluoro-4-(2-methylprop-2-enoyloxy)phenyl]-3-methylsulfanylphenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 160908180 |
| Molecular Formula | C21H19FO4S |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | [4-[3-fluoro-4-(2-methylprop-2-enoyloxy)phenyl]-3-methylsulfanylphenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(OC(=O)C(=C)C)c(F)c2)c(SC)c1 |
| InChI | InChI=1S/C21H19FO4S/c1-12(2)20(23)25-15-7-8-16(19(11-15)27-5)14-6-9-18(17(22)10-14)26-21(24)13(3)4/h6-11H,1,3H2,2,4-5H3 |
| InChIKey | SQKNUZZOXVDNQG-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|