C31H30O6S — CID 166651116
[4-[4-[4-(1-hydroxy-2-methylprop-2-enoxy)-2-(2-methylprop-2-enoyloxy)phenyl]-2-methylsulfanylphenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 166651116) has the molecular formula C31H30O6S and a molecular weight of 530.64 g/mol. Its IUPAC name is [4-[4-[4-(1-hydroxy-2-methylprop-2-enoxy)-2-(2-methylprop-2-enoyloxy)phenyl]-2-methylsulfanylphenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[4-[4-(1-hydroxy-2-methylprop-2-enoxy)-2-(2-methylprop-2-enoyloxy)phenyl]-2-methylsulfanylphenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 166651116 |
| Molecular Formula | C31H30O6S |
| Molecular Weight | 530.64 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | [4-[4-[4-(1-hydroxy-2-methylprop-2-enoxy)-2-(2-methylprop-2-enoyloxy)phenyl]-2-methylsulfanylphenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(-c3ccc(OC(O)C(=C)C)cc3OC(=O)C(=C)C)cc2SC)cc1 |
| InChI | InChI=1S/C31H30O6S/c1-18(2)29(32)35-23-11-8-21(9-12-23)26-14-10-22(16-28(26)38-7)25-15-13-24(36-30(33)19(3)4)17-27(25)37-31(34)20(5)6/h8-17,30,33H,1,3,5H2,2,4,6-7H3 |
| InChIKey | CTYADEUUTJNUGY-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.64 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|