C28H28O4 — CID 135133350
[4-[4-[4-(1-hydroxy-2-methylprop-2-enoxy)phenyl]-2,5-dimethylphenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 135133350) has the molecular formula C28H28O4 and a molecular weight of 428.53 g/mol. Its IUPAC name is [4-[4-[4-(1-hydroxy-2-methylprop-2-enoxy)phenyl]-2,5-dimethylphenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[4-[4-(1-hydroxy-2-methylprop-2-enoxy)phenyl]-2,5-dimethylphenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 135133350 |
| Molecular Formula | C28H28O4 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | [4-[4-[4-(1-hydroxy-2-methylprop-2-enoxy)phenyl]-2,5-dimethylphenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2cc(C)c(-c3ccc(OC(O)C(=C)C)cc3)cc2C)cc1 |
| InChI | InChI=1S/C28H28O4/c1-17(2)27(29)31-23-11-7-21(8-12-23)25-15-20(6)26(16-19(25)5)22-9-13-24(14-10-22)32-28(30)18(3)4/h7-16,27,29H,1,3H2,2,4-6H3 |
| InChIKey | SMPFQDIJFFOZAB-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|