C26H24O6 — CID 163941660
[4-[2-[4-(1-hydroxy-2-methylprop-2-enoxy)phenyl]ethynyl]-2-(2-methylprop-2-enoyloxy)phenyl] 2-methylprop-2-enoate (PubChem CID 163941660) has the molecular formula C26H24O6 and a molecular weight of 432.47 g/mol. Its IUPAC name is [4-[2-[4-(1-hydroxy-2-methylprop-2-enoxy)phenyl]ethynyl]-2-(2-methylprop-2-enoyloxy)phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[2-[4-(1-hydroxy-2-methylprop-2-enoxy)phenyl]ethynyl]-2-(2-methylprop-2-enoyloxy)phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163941660 |
| Molecular Formula | C26H24O6 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | [4-[2-[4-(1-hydroxy-2-methylprop-2-enoxy)phenyl]ethynyl]-2-(2-methylprop-2-enoyloxy)phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(C#Cc2ccc(OC(O)C(=C)C)cc2)cc1OC(=O)C(=C)C |
| InChI | InChI=1S/C26H24O6/c1-16(2)24(27)30-21-12-9-19(10-13-21)7-8-20-11-14-22(31-25(28)17(3)4)23(15-20)32-26(29)18(5)6/h9-15,24,27H,1,3,5H2,2,4,6H3 |
| InChIKey | RRMYSAIJSCIRNQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|