C30H30O7 — CID 135163247
[[4-[2,5-dimethyl-4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]phenoxy]-hydroxymethoxy]methyl 2-methylprop-2-enoate (PubChem CID 135163247) has the molecular formula C30H30O7 and a molecular weight of 502.56 g/mol. Its IUPAC name is [[4-[2,5-dimethyl-4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]phenoxy]-hydroxymethoxy]methyl 2-methylprop-2-enoate.
| Compound Name | [[4-[2,5-dimethyl-4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]phenoxy]-hydroxymethoxy]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 135163247 |
| Molecular Formula | C30H30O7 |
| Molecular Weight | 502.56 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | [[4-[2,5-dimethyl-4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]phenoxy]-hydroxymethoxy]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCOC(O)Oc1ccc(-c2cc(C)c(-c3ccc(OC(=O)C(=C)C)cc3)cc2C)cc1 |
| InChI | InChI=1S/C30H30O7/c1-18(2)28(31)34-17-35-30(33)37-25-13-9-23(10-14-25)27-16-20(5)26(15-21(27)6)22-7-11-24(12-8-22)36-29(32)19(3)4/h7-16,30,33H,1,3,17H2,2,4-6H3 |
| InChIKey | YXBHLHMZYGAZBH-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.56 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|