C31H28O6 — CID 118907377
[2,5-bis[4-(2-methylprop-2-enoyloxy)phenyl]phenyl] (E)-2-methylbut-2-enoate (PubChem CID 118907377) has the molecular formula C31H28O6 and a molecular weight of 496.56 g/mol. Its IUPAC name is [2,5-bis[4-(2-methylprop-2-enoyloxy)phenyl]phenyl] (E)-2-methylbut-2-enoate.
| Compound Name | [2,5-bis[4-(2-methylprop-2-enoyloxy)phenyl]phenyl] (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 118907377 |
| Molecular Formula | C31H28O6 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | [2,5-bis[4-(2-methylprop-2-enoyloxy)phenyl]phenyl] (E)-2-methylbut-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(-c3ccc(OC(=O)C(=C)C)cc3)c(OC(=O)/C(C)=C/C)c2)cc1 |
| InChI | InChI=1S/C31H28O6/c1-7-21(6)31(34)37-28-18-24(22-8-13-25(14-9-22)35-29(32)19(2)3)12-17-27(28)23-10-15-26(16-11-23)36-30(33)20(4)5/h7-18H,2,4H2,1,3,5-6H3/b21-7+ |
| InChIKey | SSUHECHMOSKHBW-QPSGOUHRSA-N |
| XLogP | 6.86 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|