C36H34O8 — CID 118907637
[4-[4-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]phenyl]-2-[(Z)-2-methylbut-2-enoyl]oxyphenyl] (Z)-2-methylbut-2-enoate (PubChem CID 118907637) has the molecular formula C36H34O8 and a molecular weight of 594.66 g/mol. Its IUPAC name is [4-[4-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]phenyl]-2-[(Z)-2-methylbut-2-enoyl]oxyphenyl] (Z)-2-methylbut-2-enoate.
| Compound Name | [4-[4-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]phenyl]-2-[(Z)-2-methylbut-2-enoyl]oxyphenyl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 118907637 |
| Molecular Formula | C36H34O8 |
| Molecular Weight | 594.66 g/mol |
| Exact Mass | 594.23 |
| IUPAC Name | [4-[4-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]phenyl]-2-[(Z)-2-methylbut-2-enoyl]oxyphenyl] (Z)-2-methylbut-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(-c3ccc(OC(=O)/C(C)=C\C)c(OC(=O)/C(C)=C\C)c3)cc2)cc1OC(=O)C(=C)C |
| InChI | InChI=1S/C36H34O8/c1-9-23(7)35(39)42-30-18-16-28(20-32(30)44-36(40)24(8)10-2)26-13-11-25(12-14-26)27-15-17-29(41-33(37)21(3)4)31(19-27)43-34(38)22(5)6/h9-20H,3,5H2,1-2,4,6-8H3/b23-9-,24-10- |
| InChIKey | LQZCPWCLDBFOSV-RJVPWCEXSA-N |
| XLogP | 7.73 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.66 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|