C34H30O8 — CID 118907533
[4-[(E)-but-2-enoyl]oxy-2,5-bis[4-(2-methylprop-2-enoyloxy)phenyl]phenyl] (E)-but-2-enoate (PubChem CID 118907533) has the molecular formula C34H30O8 and a molecular weight of 566.61 g/mol. Its IUPAC name is [4-[(E)-but-2-enoyl]oxy-2,5-bis[4-(2-methylprop-2-enoyloxy)phenyl]phenyl] (E)-but-2-enoate.
| Compound Name | [4-[(E)-but-2-enoyl]oxy-2,5-bis[4-(2-methylprop-2-enoyloxy)phenyl]phenyl] (E)-but-2-enoate |
|---|---|
| PubChem CID | 118907533 |
| Molecular Formula | C34H30O8 |
| Molecular Weight | 566.61 g/mol |
| Exact Mass | 566.19 |
| IUPAC Name | [4-[(E)-but-2-enoyl]oxy-2,5-bis[4-(2-methylprop-2-enoyloxy)phenyl]phenyl] (E)-but-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2cc(OC(=O)/C=C/C)c(-c3ccc(OC(=O)C(=C)C)cc3)cc2OC(=O)/C=C/C)cc1 |
| InChI | InChI=1S/C34H30O8/c1-7-9-31(35)41-29-19-28(24-13-17-26(18-14-24)40-34(38)22(5)6)30(42-32(36)10-8-2)20-27(29)23-11-15-25(16-12-23)39-33(37)21(3)4/h7-20H,3,5H2,1-2,4,6H3/b9-7+,10-8+ |
| InChIKey | UQYOWDHHAFRUTA-FIFLTTCUSA-N |
| XLogP | 6.95 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.61 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|