C38H31F3O7 — CID 144737067
[4-methoxy-5-[4-(2-methylprop-2-enoyloxy)phenyl]-2-[4-[4-(2-methylprop-2-enoyloxy)-3-(trifluoromethyl)phenyl]phenyl]phenyl] (E)-but-2-enoate (PubChem CID 144737067) has the molecular formula C38H31F3O7 and a molecular weight of 656.65 g/mol. Its IUPAC name is [4-methoxy-5-[4-(2-methylprop-2-enoyloxy)phenyl]-2-[4-[4-(2-methylprop-2-enoyloxy)-3-(trifluoromethyl)phenyl]phenyl]phenyl] (E)-but-2-enoate.
| Compound Name | [4-methoxy-5-[4-(2-methylprop-2-enoyloxy)phenyl]-2-[4-[4-(2-methylprop-2-enoyloxy)-3-(trifluoromethyl)phenyl]phenyl]phenyl] (E)-but-2-enoate |
|---|---|
| PubChem CID | 144737067 |
| Molecular Formula | C38H31F3O7 |
| Molecular Weight | 656.65 g/mol |
| Exact Mass | 656.20 |
| IUPAC Name | [4-methoxy-5-[4-(2-methylprop-2-enoyloxy)phenyl]-2-[4-[4-(2-methylprop-2-enoyloxy)-3-(trifluoromethyl)phenyl]phenyl]phenyl] (E)-but-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2cc(OC(=O)/C=C/C)c(-c3ccc(-c4ccc(OC(=O)C(=C)C)c(C(F)(F)F)c4)cc3)cc2OC)cc1 |
| InChI | InChI=1S/C38H31F3O7/c1-7-8-35(42)47-34-21-29(26-13-16-28(17-14-26)46-36(43)22(2)3)33(45-6)20-30(34)25-11-9-24(10-12-25)27-15-18-32(48-37(44)23(4)5)31(19-27)38(39,40)41/h7-21H,2,4H2,1,3,5-6H3/b8-7+ |
| InChIKey | RBPPBYKIRNMSLK-BQYQJAHWSA-N |
| XLogP | 9.16 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.65 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|