C26H19F3O5 — CID 123785616
[4-[2-[5-[4-prop-2-enoyloxy-3-(trifluoromethyl)phenyl]furan-2-yl]ethenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 123785616) has the molecular formula C26H19F3O5 and a molecular weight of 468.43 g/mol. Its IUPAC name is [4-[2-[5-[4-prop-2-enoyloxy-3-(trifluoromethyl)phenyl]furan-2-yl]ethenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[2-[5-[4-prop-2-enoyloxy-3-(trifluoromethyl)phenyl]furan-2-yl]ethenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123785616 |
| Molecular Formula | C26H19F3O5 |
| Molecular Weight | 468.43 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | [4-[2-[5-[4-prop-2-enoyloxy-3-(trifluoromethyl)phenyl]furan-2-yl]ethenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(-c2ccc(C=Cc3ccc(OC(=O)C(=C)C)cc3)o2)cc1C(F)(F)F |
| InChI | InChI=1S/C26H19F3O5/c1-4-24(30)34-23-13-8-18(15-21(23)26(27,28)29)22-14-12-19(32-22)9-5-17-6-10-20(11-7-17)33-25(31)16(2)3/h4-15H,1-2H2,3H3 |
| InChIKey | MSUOFEQUURZHHO-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.43 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|