C26H22O5 — CID 123286477
[4-[2-[5-[4-(2-methylprop-2-enoyloxy)phenyl]furan-2-yl]ethenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 123286477) has the molecular formula C26H22O5 and a molecular weight of 414.46 g/mol. Its IUPAC name is [4-[2-[5-[4-(2-methylprop-2-enoyloxy)phenyl]furan-2-yl]ethenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[2-[5-[4-(2-methylprop-2-enoyloxy)phenyl]furan-2-yl]ethenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123286477 |
| Molecular Formula | C26H22O5 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | [4-[2-[5-[4-(2-methylprop-2-enoyloxy)phenyl]furan-2-yl]ethenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(C=Cc2ccc(-c3ccc(OC(=O)C(=C)C)cc3)o2)cc1 |
| InChI | InChI=1S/C26H22O5/c1-17(2)25(27)30-22-11-6-19(7-12-22)5-10-21-15-16-24(29-21)20-8-13-23(14-9-20)31-26(28)18(3)4/h5-16H,1,3H2,2,4H3 |
| InChIKey | VGIOBXVNDMHSLF-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|