C38H31FO4 — CID 123579175
[4-[2-[4-[2-[2-fluoro-4-[2-[4-(2-methylprop-2-enoyloxy)phenyl]ethenyl]phenyl]ethenyl]phenyl]ethenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 123579175) has the molecular formula C38H31FO4 and a molecular weight of 570.66 g/mol. Its IUPAC name is [4-[2-[4-[2-[2-fluoro-4-[2-[4-(2-methylprop-2-enoyloxy)phenyl]ethenyl]phenyl]ethenyl]phenyl]ethenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[2-[4-[2-[2-fluoro-4-[2-[4-(2-methylprop-2-enoyloxy)phenyl]ethenyl]phenyl]ethenyl]phenyl]ethenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123579175 |
| Molecular Formula | C38H31FO4 |
| Molecular Weight | 570.66 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | [4-[2-[4-[2-[2-fluoro-4-[2-[4-(2-methylprop-2-enoyloxy)phenyl]ethenyl]phenyl]ethenyl]phenyl]ethenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(C=Cc2ccc(C=Cc3ccc(C=Cc4ccc(OC(=O)C(=C)C)cc4)cc3F)cc2)cc1 |
| InChI | InChI=1S/C38H31FO4/c1-26(2)37(40)42-34-21-15-30(16-22-34)10-7-28-5-8-29(9-6-28)13-19-33-20-14-32(25-36(33)39)12-11-31-17-23-35(24-18-31)43-38(41)27(3)4/h5-25H,1,3H2,2,4H3 |
| InChIKey | WTFHFTBGBJGLPD-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.66 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|