C32H29FO4 — CID 123598603
[4-[2-[3-fluoro-4-[2-[2-(2-methylprop-2-enoyloxymethyl)phenyl]ethenyl]phenyl]ethenyl]phenyl]methyl 2-methylprop-2-enoate (PubChem CID 123598603) has the molecular formula C32H29FO4 and a molecular weight of 496.58 g/mol. Its IUPAC name is [4-[2-[3-fluoro-4-[2-[2-(2-methylprop-2-enoyloxymethyl)phenyl]ethenyl]phenyl]ethenyl]phenyl]methyl 2-methylprop-2-enoate.
| Compound Name | [4-[2-[3-fluoro-4-[2-[2-(2-methylprop-2-enoyloxymethyl)phenyl]ethenyl]phenyl]ethenyl]phenyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123598603 |
| Molecular Formula | C32H29FO4 |
| Molecular Weight | 496.58 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | [4-[2-[3-fluoro-4-[2-[2-(2-methylprop-2-enoyloxymethyl)phenyl]ethenyl]phenyl]ethenyl]phenyl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCc1ccc(C=Cc2ccc(C=Cc3ccccc3COC(=O)C(=C)C)c(F)c2)cc1 |
| InChI | InChI=1S/C32H29FO4/c1-22(2)31(34)36-20-26-13-10-24(11-14-26)9-12-25-15-16-28(30(33)19-25)18-17-27-7-5-6-8-29(27)21-37-32(35)23(3)4/h5-19H,1,3,20-21H2,2,4H3 |
| InChIKey | YRHQPHNSWJONMX-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.58 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|