C30H25FO4 — CID 123359994
[2-[2-[3-fluoro-4-[2-[2-(prop-2-enoyloxymethyl)phenyl]ethenyl]phenyl]ethenyl]phenyl]methyl prop-2-enoate (PubChem CID 123359994) has the molecular formula C30H25FO4 and a molecular weight of 468.52 g/mol. Its IUPAC name is [2-[2-[3-fluoro-4-[2-[2-(prop-2-enoyloxymethyl)phenyl]ethenyl]phenyl]ethenyl]phenyl]methyl prop-2-enoate.
| Compound Name | [2-[2-[3-fluoro-4-[2-[2-(prop-2-enoyloxymethyl)phenyl]ethenyl]phenyl]ethenyl]phenyl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 123359994 |
| Molecular Formula | C30H25FO4 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | [2-[2-[3-fluoro-4-[2-[2-(prop-2-enoyloxymethyl)phenyl]ethenyl]phenyl]ethenyl]phenyl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCc1ccccc1C=Cc1ccc(C=Cc2ccccc2COC(=O)C=C)c(F)c1 |
| InChI | InChI=1S/C30H25FO4/c1-3-29(32)34-20-26-11-7-5-9-23(26)15-13-22-14-16-25(28(31)19-22)18-17-24-10-6-8-12-27(24)21-35-30(33)4-2/h3-19H,1-2,20-21H2 |
| InChIKey | YTQFQZMMFKRRRP-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|