C30H25FO5 — CID 123770109
2-[4-[2-[4-[2-(2-fluoro-4-prop-2-enoyloxyphenyl)ethenyl]phenyl]ethenyl]phenoxy]ethyl prop-2-enoate (PubChem CID 123770109) has the molecular formula C30H25FO5 and a molecular weight of 484.52 g/mol. Its IUPAC name is 2-[4-[2-[4-[2-(2-fluoro-4-prop-2-enoyloxyphenyl)ethenyl]phenyl]ethenyl]phenoxy]ethyl prop-2-enoate.
| Compound Name | 2-[4-[2-[4-[2-(2-fluoro-4-prop-2-enoyloxyphenyl)ethenyl]phenyl]ethenyl]phenoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 123770109 |
| Molecular Formula | C30H25FO5 |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 2-[4-[2-[4-[2-(2-fluoro-4-prop-2-enoyloxyphenyl)ethenyl]phenyl]ethenyl]phenoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOc1ccc(C=Cc2ccc(C=Cc3ccc(OC(=O)C=C)cc3F)cc2)cc1 |
| InChI | InChI=1S/C30H25FO5/c1-3-29(32)35-20-19-34-26-16-12-24(13-17-26)10-7-22-5-8-23(9-6-22)11-14-25-15-18-27(21-28(25)31)36-30(33)4-2/h3-18,21H,1-2,19-20H2 |
| InChIKey | AHNUCRWHDUMIOL-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|