C34H35FO5 — CID 123294887
2-[2-[2-[3-fluoro-4-[2-[2-[2-(2-methylprop-2-enoxy)ethoxy]phenyl]ethenyl]phenyl]ethenyl]phenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 123294887) has the molecular formula C34H35FO5 and a molecular weight of 542.65 g/mol. Its IUPAC name is 2-[2-[2-[3-fluoro-4-[2-[2-[2-(2-methylprop-2-enoxy)ethoxy]phenyl]ethenyl]phenyl]ethenyl]phenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[2-[3-fluoro-4-[2-[2-[2-(2-methylprop-2-enoxy)ethoxy]phenyl]ethenyl]phenyl]ethenyl]phenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123294887 |
| Molecular Formula | C34H35FO5 |
| Molecular Weight | 542.65 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | 2-[2-[2-[3-fluoro-4-[2-[2-[2-(2-methylprop-2-enoxy)ethoxy]phenyl]ethenyl]phenyl]ethenyl]phenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)COCCOc1ccccc1C=Cc1ccc(C=Cc2ccccc2OCCOC(=O)C(=C)C)cc1F |
| InChI | InChI=1S/C34H35FO5/c1-25(2)24-37-19-20-38-33-12-8-6-10-30(33)18-17-28-15-13-27(23-31(28)35)14-16-29-9-5-7-11-32(29)39-21-22-40-34(36)26(3)4/h5-18,23H,1,3,19-22,24H2,2,4H3 |
| InChIKey | YYSQDTRSQXHTGO-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.65 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|