C30H27FO4 — CID 138525541
[4-[(E)-2-[3-fluoro-4-[(E)-2-[4-(2-methylprop-2-enoyloxy)phenyl]ethenyl]phenyl]ethenyl]phenyl] 2-methylpropanoate (PubChem CID 138525541) has the molecular formula C30H27FO4 and a molecular weight of 470.54 g/mol. Its IUPAC name is [4-[(E)-2-[3-fluoro-4-[(E)-2-[4-(2-methylprop-2-enoyloxy)phenyl]ethenyl]phenyl]ethenyl]phenyl] 2-methylpropanoate.
| Compound Name | [4-[(E)-2-[3-fluoro-4-[(E)-2-[4-(2-methylprop-2-enoyloxy)phenyl]ethenyl]phenyl]ethenyl]phenyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 138525541 |
| Molecular Formula | C30H27FO4 |
| Molecular Weight | 470.54 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | [4-[(E)-2-[3-fluoro-4-[(E)-2-[4-(2-methylprop-2-enoyloxy)phenyl]ethenyl]phenyl]ethenyl]phenyl] 2-methylpropanoate |
| SMILES | C=C(C)C(=O)Oc1ccc(/C=C/c2ccc(/C=C/c3ccc(OC(=O)C(C)C)cc3)cc2F)cc1 |
| InChI | InChI=1S/C30H27FO4/c1-20(2)29(32)34-26-15-9-22(10-16-26)5-6-24-8-14-25(28(31)19-24)13-7-23-11-17-27(18-12-23)35-30(33)21(3)4/h5-20H,3H2,1-2,4H3/b6-5+,13-7+ |
| InChIKey | GMRHLSGSOXSKQG-WOXAVFRBSA-N |
| XLogP | 7.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.54 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|