C36H36O6 — CID 118907437
[4-[(E)-2-[2,5-bis(2-methylprop-2-enoxy)-4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]ethenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 118907437) has the molecular formula C36H36O6 and a molecular weight of 564.68 g/mol. Its IUPAC name is [4-[(E)-2-[2,5-bis(2-methylprop-2-enoxy)-4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]ethenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[(E)-2-[2,5-bis(2-methylprop-2-enoxy)-4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]ethenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118907437 |
| Molecular Formula | C36H36O6 |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 564.25 |
| IUPAC Name | [4-[(E)-2-[2,5-bis(2-methylprop-2-enoxy)-4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]ethenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)COc1cc(-c2ccc(OC(=O)C(=C)C)cc2)c(OCC(=C)C)cc1/C=C/c1ccc(OC(=O)C(=C)C)cc1 |
| InChI | InChI=1S/C36H36O6/c1-23(2)21-39-33-20-32(28-13-17-31(18-14-28)42-36(38)26(7)8)34(40-22-24(3)4)19-29(33)12-9-27-10-15-30(16-11-27)41-35(37)25(5)6/h9-20H,1,3,5,7,21-22H2,2,4,6,8H3/b12-9+ |
| InChIKey | BFWWNXJFCWPTLM-FMIVXFBMSA-N |
| XLogP | 8.40 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|