C18H18O3 — CID 123278935
[6-(2-methylprop-2-enoxy)naphthalen-2-yl] 2-methylprop-2-enoate (PubChem CID 123278935) has the molecular formula C18H18O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is [6-(2-methylprop-2-enoxy)naphthalen-2-yl] 2-methylprop-2-enoate.
| Compound Name | [6-(2-methylprop-2-enoxy)naphthalen-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123278935 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | [6-(2-methylprop-2-enoxy)naphthalen-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)COc1ccc2cc(OC(=O)C(=C)C)ccc2c1 |
| InChI | InChI=1S/C18H18O3/c1-12(2)11-20-16-7-5-15-10-17(8-6-14(15)9-16)21-18(19)13(3)4/h5-10H,1,3,11H2,2,4H3 |
| InChIKey | ZXGGJINOMQGLCR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|