C31H26F2O6 — CID 144737094
[4-[(E)-2-[5-(2,2-difluoroethenoxy)-4-(4-methoxyphenyl)-2-(2-methylprop-2-enoyloxy)phenyl]ethenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 144737094) has the molecular formula C31H26F2O6 and a molecular weight of 532.54 g/mol. Its IUPAC name is [4-[(E)-2-[5-(2,2-difluoroethenoxy)-4-(4-methoxyphenyl)-2-(2-methylprop-2-enoyloxy)phenyl]ethenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[(E)-2-[5-(2,2-difluoroethenoxy)-4-(4-methoxyphenyl)-2-(2-methylprop-2-enoyloxy)phenyl]ethenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 144737094 |
| Molecular Formula | C31H26F2O6 |
| Molecular Weight | 532.54 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | [4-[(E)-2-[5-(2,2-difluoroethenoxy)-4-(4-methoxyphenyl)-2-(2-methylprop-2-enoyloxy)phenyl]ethenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(/C=C/c2cc(OC=C(F)F)c(-c3ccc(OC)cc3)cc2OC(=O)C(=C)C)cc1 |
| InChI | InChI=1S/C31H26F2O6/c1-19(2)30(34)38-25-12-7-21(8-13-25)6-9-23-16-28(37-18-29(32)33)26(17-27(23)39-31(35)20(3)4)22-10-14-24(36-5)15-11-22/h6-18H,1,3H2,2,4-5H3/b9-6+ |
| InChIKey | YCLIHAOPBZEJBG-RMKNXTFCSA-N |
| XLogP | 7.61 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.54 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|