C38H35FO8 — CID 118975620
[4-[(E)-2-[4-[3,5-dimethyl-4-(2-methylprop-2-enoyloxy)phenyl]-2,5-bis(2-methylprop-2-enoyloxy)phenyl]ethenyl]-2-fluorophenyl] 2-methylprop-2-enoate (PubChem CID 118975620) has the molecular formula C38H35FO8 and a molecular weight of 638.69 g/mol. Its IUPAC name is [4-[(E)-2-[4-[3,5-dimethyl-4-(2-methylprop-2-enoyloxy)phenyl]-2,5-bis(2-methylprop-2-enoyloxy)phenyl]ethenyl]-2-fluorophenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[(E)-2-[4-[3,5-dimethyl-4-(2-methylprop-2-enoyloxy)phenyl]-2,5-bis(2-methylprop-2-enoyloxy)phenyl]ethenyl]-2-fluorophenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118975620 |
| Molecular Formula | C38H35FO8 |
| Molecular Weight | 638.69 g/mol |
| Exact Mass | 638.23 |
| IUPAC Name | [4-[(E)-2-[4-[3,5-dimethyl-4-(2-methylprop-2-enoyloxy)phenyl]-2,5-bis(2-methylprop-2-enoyloxy)phenyl]ethenyl]-2-fluorophenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(/C=C/c2cc(OC(=O)C(=C)C)c(-c3cc(C)c(OC(=O)C(=C)C)c(C)c3)cc2OC(=O)C(=C)C)cc1F |
| InChI | InChI=1S/C38H35FO8/c1-20(2)35(40)44-31-14-12-26(17-30(31)39)11-13-27-18-33(46-37(42)22(5)6)29(19-32(27)45-36(41)21(3)4)28-15-24(9)34(25(10)16-28)47-38(43)23(7)8/h11-19H,1,3,5,7H2,2,4,6,8-10H3/b13-11+ |
| InChIKey | CQGWVZDHRFYJKG-ACCUITESSA-N |
| XLogP | 8.21 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.69 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|