C37H31FO10 — CID 118975504
[4-[4-[(E)-3-[2-fluoro-4-(2-methylprop-2-enoyloxy)phenyl]prop-2-enoyl]oxy-2,5-bis(2-methylprop-2-enoyloxy)phenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 118975504) has the molecular formula C37H31FO10 and a molecular weight of 654.64 g/mol. Its IUPAC name is [4-[4-[(E)-3-[2-fluoro-4-(2-methylprop-2-enoyloxy)phenyl]prop-2-enoyl]oxy-2,5-bis(2-methylprop-2-enoyloxy)phenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[4-[(E)-3-[2-fluoro-4-(2-methylprop-2-enoyloxy)phenyl]prop-2-enoyl]oxy-2,5-bis(2-methylprop-2-enoyloxy)phenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118975504 |
| Molecular Formula | C37H31FO10 |
| Molecular Weight | 654.64 g/mol |
| Exact Mass | 654.19 |
| IUPAC Name | [4-[4-[(E)-3-[2-fluoro-4-(2-methylprop-2-enoyloxy)phenyl]prop-2-enoyl]oxy-2,5-bis(2-methylprop-2-enoyloxy)phenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2cc(OC(=O)C(=C)C)c(OC(=O)/C=C/c3ccc(OC(=O)C(=C)C)cc3F)cc2OC(=O)C(=C)C)cc1 |
| InChI | InChI=1S/C37H31FO10/c1-20(2)34(40)44-26-13-9-24(10-14-26)28-18-31(48-37(43)23(7)8)32(19-30(28)47-36(42)22(5)6)46-33(39)16-12-25-11-15-27(17-29(25)38)45-35(41)21(3)4/h9-19H,1,3,5,7H2,2,4,6,8H3/b16-12+ |
| InChIKey | SUVLTBMVVOSRRM-FOWTUZBSSA-N |
| XLogP | 7.04 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.64 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|