C32H32O7 — CID 134548317
[4-methoxy-2-[4-(2-methylpropanoyloxy)phenyl]-5-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl] 3-methylbut-2-enoate (PubChem CID 134548317) has the molecular formula C32H32O7 and a molecular weight of 528.60 g/mol. Its IUPAC name is [4-methoxy-2-[4-(2-methylpropanoyloxy)phenyl]-5-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl] 3-methylbut-2-enoate.
| Compound Name | [4-methoxy-2-[4-(2-methylpropanoyloxy)phenyl]-5-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 134548317 |
| Molecular Formula | C32H32O7 |
| Molecular Weight | 528.60 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | [4-methoxy-2-[4-(2-methylpropanoyloxy)phenyl]-5-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl] 3-methylbut-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2cc(OC(=O)C=C(C)C)c(-c3ccc(OC(=O)C(C)C)cc3)cc2OC)cc1 |
| InChI | InChI=1S/C32H32O7/c1-19(2)16-30(33)39-29-18-26(22-8-12-24(13-9-22)37-31(34)20(3)4)28(36-7)17-27(29)23-10-14-25(15-11-23)38-32(35)21(5)6/h8-18,21H,3H2,1-2,4-7H3 |
| InChIKey | AASIITHEEOVUHJ-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.60 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|