C40H43NO9 — CID 126564418
[4-[3-[bis[2-(2-methylprop-2-enoyloxy)ethyl]carbamoyl]-5-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]phenyl] 2,2-dimethylpropanoate (PubChem CID 126564418) has the molecular formula C40H43NO9 and a molecular weight of 681.78 g/mol. Its IUPAC name is [4-[3-[bis[2-(2-methylprop-2-enoyloxy)ethyl]carbamoyl]-5-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-[3-[bis[2-(2-methylprop-2-enoyloxy)ethyl]carbamoyl]-5-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 126564418 |
| Molecular Formula | C40H43NO9 |
| Molecular Weight | 681.78 g/mol |
| Exact Mass | 681.29 |
| IUPAC Name | [4-[3-[bis[2-(2-methylprop-2-enoyloxy)ethyl]carbamoyl]-5-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]phenyl] 2,2-dimethylpropanoate |
| SMILES | C=C(C)C(=O)OCCN(CCOC(=O)C(=C)C)C(=O)c1cc(-c2ccc(OC(=O)C(=C)C)cc2)cc(-c2ccc(OC(=O)C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C40H43NO9/c1-25(2)36(43)47-20-18-41(19-21-48-37(44)26(3)4)35(42)32-23-30(28-10-14-33(15-11-28)49-38(45)27(5)6)22-31(24-32)29-12-16-34(17-13-29)50-39(46)40(7,8)9/h10-17,22-24H,1,3,5,18-21H2,2,4,6-9H3 |
| InChIKey | ZLXYJALMCKSZJR-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 125.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.78 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|