C36H38O9 — CID 174246226
2-(2,2-dimethylpropanoyloxy)ethyl 3-[2-(2-methylprop-2-enoyloxy)ethoxy]-4-[4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]benzoate (PubChem CID 174246226) has the molecular formula C36H38O9 and a molecular weight of 614.69 g/mol. Its IUPAC name is 2-(2,2-dimethylpropanoyloxy)ethyl 3-[2-(2-methylprop-2-enoyloxy)ethoxy]-4-[4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]benzoate.
| Compound Name | 2-(2,2-dimethylpropanoyloxy)ethyl 3-[2-(2-methylprop-2-enoyloxy)ethoxy]-4-[4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]benzoate |
|---|---|
| PubChem CID | 174246226 |
| Molecular Formula | C36H38O9 |
| Molecular Weight | 614.69 g/mol |
| Exact Mass | 614.25 |
| IUPAC Name | 2-(2,2-dimethylpropanoyloxy)ethyl 3-[2-(2-methylprop-2-enoyloxy)ethoxy]-4-[4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]benzoate |
| SMILES | C=C(C)C(=O)OCCOc1cc(C(=O)OCCOC(=O)C(C)(C)C)ccc1-c1ccc(-c2ccc(OC(=O)C(=C)C)cc2)cc1 |
| InChI | InChI=1S/C36H38O9/c1-23(2)32(37)42-19-18-41-31-22-28(34(39)43-20-21-44-35(40)36(5,6)7)14-17-30(31)27-10-8-25(9-11-27)26-12-15-29(16-13-26)45-33(38)24(3)4/h8-17,22H,1,3,18-21H2,2,4-7H3 |
| InChIKey | ZOMUJPUUBCOXFW-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.69 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|