C35H40O9 — CID 154931544
[4-[4-(3-hydroxy-2,2-dimethylpropanoyl)oxybutoxy]phenyl] 4-[4-[3-(2-methylprop-2-enoyloxy)propoxy]phenyl]benzoate (PubChem CID 154931544) has the molecular formula C35H40O9 and a molecular weight of 604.70 g/mol. Its IUPAC name is [4-[4-(3-hydroxy-2,2-dimethylpropanoyl)oxybutoxy]phenyl] 4-[4-[3-(2-methylprop-2-enoyloxy)propoxy]phenyl]benzoate.
| Compound Name | [4-[4-(3-hydroxy-2,2-dimethylpropanoyl)oxybutoxy]phenyl] 4-[4-[3-(2-methylprop-2-enoyloxy)propoxy]phenyl]benzoate |
|---|---|
| PubChem CID | 154931544 |
| Molecular Formula | C35H40O9 |
| Molecular Weight | 604.70 g/mol |
| Exact Mass | 604.27 |
| IUPAC Name | [4-[4-(3-hydroxy-2,2-dimethylpropanoyl)oxybutoxy]phenyl] 4-[4-[3-(2-methylprop-2-enoyloxy)propoxy]phenyl]benzoate |
| SMILES | C=C(C)C(=O)OCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(OCCCCOC(=O)C(C)(C)CO)cc3)cc2)cc1 |
| InChI | InChI=1S/C35H40O9/c1-25(2)32(37)42-23-7-22-41-29-14-12-27(13-15-29)26-8-10-28(11-9-26)33(38)44-31-18-16-30(17-19-31)40-20-5-6-21-43-34(39)35(3,4)24-36/h8-19,36H,1,5-7,20-24H2,2-4H3 |
| InChIKey | QVRIOLFUUVLIIA-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.70 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|