C36H37NO9 — CID 163793729
2-[2-[3-[3-amino-4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]-5-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]-2-oxoethoxy]ethyl 2-methylprop-2-enoate (PubChem CID 163793729) has the molecular formula C36H37NO9 and a molecular weight of 627.69 g/mol. Its IUPAC name is 2-[2-[3-[3-amino-4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]-5-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]-2-oxoethoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[3-[3-amino-4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]-5-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]-2-oxoethoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163793729 |
| Molecular Formula | C36H37NO9 |
| Molecular Weight | 627.69 g/mol |
| Exact Mass | 627.25 |
| IUPAC Name | 2-[2-[3-[3-amino-4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]-5-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]-2-oxoethoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOCC(=O)c1cc(-c2ccc(OC(=O)C(=C)C)cc2)cc(-c2ccc(OCCOC(=O)C(=C)C)c(N)c2)c1 |
| InChI | InChI=1S/C36H37NO9/c1-22(2)34(39)44-14-13-42-21-32(38)29-18-27(25-7-10-30(11-8-25)46-36(41)24(5)6)17-28(19-29)26-9-12-33(31(37)20-26)43-15-16-45-35(40)23(3)4/h7-12,17-20H,1,3,5,13-16,21,37H2,2,4,6H3 |
| InChIKey | MYZIIMAIDTYZDR-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 140.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.69 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|