C34H36O8 — CID 155446398
2-[3-[2-(1-hydroxy-2-methylprop-2-enoxy)ethoxy]-5-[3-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]phenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 155446398) has the molecular formula C34H36O8 and a molecular weight of 572.65 g/mol. Its IUPAC name is 2-[3-[2-(1-hydroxy-2-methylprop-2-enoxy)ethoxy]-5-[3-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]phenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[3-[2-(1-hydroxy-2-methylprop-2-enoxy)ethoxy]-5-[3-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]phenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155446398 |
| Molecular Formula | C34H36O8 |
| Molecular Weight | 572.65 g/mol |
| Exact Mass | 572.24 |
| IUPAC Name | 2-[3-[2-(1-hydroxy-2-methylprop-2-enoxy)ethoxy]-5-[3-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]phenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1cc(OCCOC(O)C(=C)C)cc(-c2cccc(-c3ccc(OC(=O)C(=C)C)cc3)c2)c1 |
| InChI | InChI=1S/C34H36O8/c1-22(2)32(35)40-16-14-38-30-19-28(20-31(21-30)39-15-17-41-33(36)23(3)4)27-9-7-8-26(18-27)25-10-12-29(13-11-25)42-34(37)24(5)6/h7-13,18-21,32,35H,1,3,5,14-17H2,2,4,6H3 |
| InChIKey | JNWJXMPCDGLHIS-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.65 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|