C32H30O8 — CID 118907751
[4-[3-[3,5-bis(2-prop-2-enoyloxyethoxy)phenyl]phenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 118907751) has the molecular formula C32H30O8 and a molecular weight of 542.58 g/mol. Its IUPAC name is [4-[3-[3,5-bis(2-prop-2-enoyloxyethoxy)phenyl]phenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[3-[3,5-bis(2-prop-2-enoyloxyethoxy)phenyl]phenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118907751 |
| Molecular Formula | C32H30O8 |
| Molecular Weight | 542.58 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | [4-[3-[3,5-bis(2-prop-2-enoyloxyethoxy)phenyl]phenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=CC(=O)OCCOc1cc(OCCOC(=O)C=C)cc(-c2cccc(-c3ccc(OC(=O)C(=C)C)cc3)c2)c1 |
| InChI | InChI=1S/C32H30O8/c1-5-30(33)38-16-14-36-28-19-26(20-29(21-28)37-15-17-39-31(34)6-2)25-9-7-8-24(18-25)23-10-12-27(13-11-23)40-32(35)22(3)4/h5-13,18-21H,1-3,14-17H2,4H3 |
| InChIKey | CYCPVBKNKFSFCF-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.58 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|