C32H30O6 — CID 123161825
6-prop-2-enoyloxyhex-3-enyl 4-[4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]benzoate (PubChem CID 123161825) has the molecular formula C32H30O6 and a molecular weight of 510.59 g/mol. Its IUPAC name is 6-prop-2-enoyloxyhex-3-enyl 4-[4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]benzoate.
| Compound Name | 6-prop-2-enoyloxyhex-3-enyl 4-[4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]benzoate |
|---|---|
| PubChem CID | 123161825 |
| Molecular Formula | C32H30O6 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | 6-prop-2-enoyloxyhex-3-enyl 4-[4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]benzoate |
| SMILES | C=CC(=O)OCCC=CCCOC(=O)c1ccc(-c2ccc(-c3ccc(OC(=O)C(=C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H30O6/c1-4-30(33)36-21-7-5-6-8-22-37-32(35)28-15-13-26(14-16-28)24-9-11-25(12-10-24)27-17-19-29(20-18-27)38-31(34)23(2)3/h4-6,9-20H,1-2,7-8,21-22H2,3H3 |
| InChIKey | NAVCNOATDQZHRU-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|