C39H60O7 — CID 166645823
[4-[2-[(3-hydroxy-2,2-dimethylpropanoyl)oxymethyl]-3-(2-methylprop-2-enoyloxy)propyl]phenyl] 4-(4-heptylcyclohexyl)cyclohexane-1-carboxylate (PubChem CID 166645823) has the molecular formula C39H60O7 and a molecular weight of 640.90 g/mol. Its IUPAC name is [4-[2-[(3-hydroxy-2,2-dimethylpropanoyl)oxymethyl]-3-(2-methylprop-2-enoyloxy)propyl]phenyl] 4-(4-heptylcyclohexyl)cyclohexane-1-carboxylate.
| Compound Name | [4-[2-[(3-hydroxy-2,2-dimethylpropanoyl)oxymethyl]-3-(2-methylprop-2-enoyloxy)propyl]phenyl] 4-(4-heptylcyclohexyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 166645823 |
| Molecular Formula | C39H60O7 |
| Molecular Weight | 640.90 g/mol |
| Exact Mass | 640.43 |
| IUPAC Name | [4-[2-[(3-hydroxy-2,2-dimethylpropanoyl)oxymethyl]-3-(2-methylprop-2-enoyloxy)propyl]phenyl] 4-(4-heptylcyclohexyl)cyclohexane-1-carboxylate |
| SMILES | C=C(C)C(=O)OCC(COC(=O)C(C)(C)CO)Cc1ccc(OC(=O)C2CCC(C3CCC(CCCCCCC)CC3)CC2)cc1 |
| InChI | InChI=1S/C39H60O7/c1-6-7-8-9-10-11-29-12-16-32(17-13-29)33-18-20-34(21-19-33)37(42)46-35-22-14-30(15-23-35)24-31(25-44-36(41)28(2)3)26-45-38(43)39(4,5)27-40/h14-15,22-23,29,31-34,40H,2,6-13,16-21,24-27H2,1,3-5H3 |
| InChIKey | CWMLMJWSTCJFKL-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.90 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|