C16H10F4O2 — CID 126551736
[4-(2,3-difluorophenyl)-2,6-difluorophenyl] 2-methylprop-2-enoate (PubChem CID 126551736) has the molecular formula C16H10F4O2 and a molecular weight of 310.25 g/mol. Its IUPAC name is [4-(2,3-difluorophenyl)-2,6-difluorophenyl] 2-methylprop-2-enoate.
| Compound Name | [4-(2,3-difluorophenyl)-2,6-difluorophenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 126551736 |
| Molecular Formula | C16H10F4O2 |
| Molecular Weight | 310.25 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | [4-(2,3-difluorophenyl)-2,6-difluorophenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1c(F)cc(-c2cccc(F)c2F)cc1F |
| InChI | InChI=1S/C16H10F4O2/c1-8(2)16(21)22-15-12(18)6-9(7-13(15)19)10-4-3-5-11(17)14(10)20/h3-7H,1H2,2H3 |
| InChIKey | FUSWYTFDGMQWJC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.25 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|