C11H8F4O2 — CID 89308664
(2,3,5,6-tetrafluoro-4-methylphenyl) 2-methylprop-2-enoate (PubChem CID 89308664) has the molecular formula C11H8F4O2 and a molecular weight of 248.17 g/mol. Its IUPAC name is (2,3,5,6-tetrafluoro-4-methylphenyl) 2-methylprop-2-enoate.
| Compound Name | (2,3,5,6-tetrafluoro-4-methylphenyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89308664 |
| Molecular Formula | C11H8F4O2 |
| Molecular Weight | 248.17 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | (2,3,5,6-tetrafluoro-4-methylphenyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1c(F)c(F)c(C)c(F)c1F |
| InChI | InChI=1S/C11H8F4O2/c1-4(2)11(16)17-10-8(14)6(12)5(3)7(13)9(10)15/h1H2,2-3H3 |
| InChIKey | RMZCZHPYBCXDEB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.17 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|