C10H15N5O2 — CID 168968326
(2,3,4,5,6-pentaaminophenyl) 2-methylprop-2-enoate (PubChem CID 168968326) has the molecular formula C10H15N5O2 and a molecular weight of 237.26 g/mol. Its IUPAC name is (2,3,4,5,6-pentaaminophenyl) 2-methylprop-2-enoate.
| Compound Name | (2,3,4,5,6-pentaaminophenyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 168968326 |
| Molecular Formula | C10H15N5O2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | (2,3,4,5,6-pentaaminophenyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1c(N)c(N)c(N)c(N)c1N |
| InChI | InChI=1S/C10H15N5O2/c1-3(2)10(16)17-9-7(14)5(12)4(11)6(13)8(9)15/h1,11-15H2,2H3 |
| InChIKey | GODFOVPUCXSUAW-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 156.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|