C15H19NO3 — CID 162138067
(2,6-dimethylphenyl) 2-methylprop-2-enoate;prop-2-enamide (PubChem CID 162138067) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is (2,6-dimethylphenyl) 2-methylprop-2-enoate;prop-2-enamide.
| Compound Name | (2,6-dimethylphenyl) 2-methylprop-2-enoate;prop-2-enamide |
|---|---|
| PubChem CID | 162138067 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | (2,6-dimethylphenyl) 2-methylprop-2-enoate;prop-2-enamide |
| SMILES | C=C(C)C(=O)Oc1c(C)cccc1C.C=CC(N)=O |
| InChI | InChI=1S/C12H14O2.C3H5NO/c1-8(2)12(13)14-11-9(3)6-5-7-10(11)4;1-2-3(4)5/h5-7H,1H2,2-4H3;2H,1H2,(H2,4,5) |
| InChIKey | ZJOAPTUYPYSJEQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|