About (2-tert-butyl-6-methylphenyl) 2-methylprop-2-enoate;ethane;prop-1-ene
(2-tert-butyl-6-methylphenyl) 2-methylprop-2-enoate;ethane;prop-1-ene (PubChem CID 177153144) has the molecular formula C20H32O2
and a molecular weight of 304.47 g/mol. Its IUPAC name is (2-tert-butyl-6-methylphenyl) 2-methylprop-2-enoate;ethane;prop-1-ene.
Molecular Properties
| Compound Name | (2-tert-butyl-6-methylphenyl) 2-methylprop-2-enoate;ethane;prop-1-ene |
| PubChem CID | 177153144 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (2-tert-butyl-6-methylphenyl) 2-methylprop-2-enoate;ethane;prop-1-ene |
| SMILES | C=C(C)C(=O)Oc1c(C)cccc1C(C)(C)C.C=CC.CC |
| InChI | InChI=1S/C15H20O2.C3H6.C2H6/c1-10(2)14(16)17-13-11(3)8-7-9-12(13)15(4,5)6;1-3-2;1-2/h7-9H,1H2,2-6H3;3H,1H2,2H3;1-2H3 |
| InChIKey | MEYMXWWSYMBORM-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-tert-butyl-6-methylphenyl) 2-methylprop-2-enoate;ethane;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-tert-butyl-6-methylphenyl) 2-methylprop-2-enoate;ethane;prop-1-ene?
The IUPAC name of (2-tert-butyl-6-methylphenyl) 2-methylprop-2-enoate;ethane;prop-1-ene (CID 177153144) is (2-tert-butyl-6-methylphenyl) 2-methylprop-2-enoate;ethane;prop-1-ene.
What is the SMILES notation for (2-tert-butyl-6-methylphenyl) 2-methylprop-2-enoate;ethane;prop-1-ene?
The canonical SMILES for (2-tert-butyl-6-methylphenyl) 2-methylprop-2-enoate;ethane;prop-1-ene is C=C(C)C(=O)Oc1c(C)cccc1C(C)(C)C.C=CC.CC.
What is the InChIKey of (2-tert-butyl-6-methylphenyl) 2-methylprop-2-enoate;ethane;prop-1-ene?
The InChIKey is MEYMXWWSYMBORM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O2.C3H6.C2H6/c1-10(2)14(16)17-13-11(3)8-7-9-12(13)15(4,5)6;1-3-2;1-2/h7-9H,1H2,2-6H3;3H,1H2,2H3;1-2H3.
What are the key properties of (2-tert-butyl-6-methylphenyl) 2-methylprop-2-enoate;ethane;prop-1-ene?
(2-tert-butyl-6-methylphenyl) 2-methylprop-2-enoate;ethane;prop-1-ene has a molecular weight of 304.47 g/mol, XLogP of 5.99, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-tert-butyl-6-methylphenyl) 2-methylprop-2-enoate;ethane;prop-1-ene is sourced from PubChem (CID 177153144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).