C19H27NO3 — CID 160689388
N-tert-butyl-2-methylprop-2-enamide;(2-methylphenyl) 2-methylprop-2-enoate (PubChem CID 160689388) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is N-tert-butyl-2-methylprop-2-enamide;(2-methylphenyl) 2-methylprop-2-enoate.
| Compound Name | N-tert-butyl-2-methylprop-2-enamide;(2-methylphenyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 160689388 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | N-tert-butyl-2-methylprop-2-enamide;(2-methylphenyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)NC(C)(C)C.C=C(C)C(=O)Oc1ccccc1C |
| InChI | InChI=1S/C11H12O2.C8H15NO/c1-8(2)11(12)13-10-7-5-4-6-9(10)3;1-6(2)7(10)9-8(3,4)5/h4-7H,1H2,2-3H3;1H2,2-5H3,(H,9,10) |
| InChIKey | RPFAMPGAUJXJOX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|