C23H18F6O4 — CID 22141672
[2-[1,1,1,3,3,3-hexafluoro-2-[2-(2-methylprop-2-enoyloxy)phenyl]propan-2-yl]phenyl] 2-methylprop-2-enoate (PubChem CID 22141672) has the molecular formula C23H18F6O4 and a molecular weight of 472.38 g/mol. Its IUPAC name is [2-[1,1,1,3,3,3-hexafluoro-2-[2-(2-methylprop-2-enoyloxy)phenyl]propan-2-yl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [2-[1,1,1,3,3,3-hexafluoro-2-[2-(2-methylprop-2-enoyloxy)phenyl]propan-2-yl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 22141672 |
| Molecular Formula | C23H18F6O4 |
| Molecular Weight | 472.38 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | [2-[1,1,1,3,3,3-hexafluoro-2-[2-(2-methylprop-2-enoyloxy)phenyl]propan-2-yl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccccc1C(c1ccccc1OC(=O)C(=C)C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C23H18F6O4/c1-13(2)19(30)32-17-11-7-5-9-15(17)21(22(24,25)26,23(27,28)29)16-10-6-8-12-18(16)33-20(31)14(3)4/h5-12H,1,3H2,2,4H3 |
| InChIKey | OMSZHYAATRYCQG-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.38 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|