C19H26Br2O2 — CID 70386256
[2-(1,1-dibromononyl)phenyl] 2-methylprop-2-enoate (PubChem CID 70386256) has the molecular formula C19H26Br2O2 and a molecular weight of 446.22 g/mol. Its IUPAC name is [2-(1,1-dibromononyl)phenyl] 2-methylprop-2-enoate.
| Compound Name | [2-(1,1-dibromononyl)phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 70386256 |
| Molecular Formula | C19H26Br2O2 |
| Molecular Weight | 446.22 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | [2-(1,1-dibromononyl)phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccccc1C(Br)(Br)CCCCCCCC |
| InChI | InChI=1S/C19H26Br2O2/c1-4-5-6-7-8-11-14-19(20,21)16-12-9-10-13-17(16)23-18(22)15(2)3/h9-10,12-13H,2,4-8,11,14H2,1,3H3 |
| InChIKey | BBRHKQFNQMYIJY-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.22 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|