C21H29F3O4 — CID 129118587
[2-[3-(4,4,4-trifluoro-3-hydroxy-2,3-dimethylbutan-2-yl)oxypentan-3-yl]phenyl] 2-methylprop-2-enoate (PubChem CID 129118587) has the molecular formula C21H29F3O4 and a molecular weight of 402.45 g/mol. Its IUPAC name is [2-[3-(4,4,4-trifluoro-3-hydroxy-2,3-dimethylbutan-2-yl)oxypentan-3-yl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [2-[3-(4,4,4-trifluoro-3-hydroxy-2,3-dimethylbutan-2-yl)oxypentan-3-yl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 129118587 |
| Molecular Formula | C21H29F3O4 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | [2-[3-(4,4,4-trifluoro-3-hydroxy-2,3-dimethylbutan-2-yl)oxypentan-3-yl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccccc1C(CC)(CC)OC(C)(C)C(C)(O)C(F)(F)F |
| InChI | InChI=1S/C21H29F3O4/c1-8-20(9-2,28-18(5,6)19(7,26)21(22,23)24)15-12-10-11-13-16(15)27-17(25)14(3)4/h10-13,26H,3,8-9H2,1-2,4-7H3 |
| InChIKey | KUDJSJXUXDUEII-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|