C14H12F6O3 — CID 129120853
[3,3,3-trifluoro-2-hydroxy-1-phenyl-2-(trifluoromethyl)propyl] 2-methylprop-2-enoate (PubChem CID 129120853) has the molecular formula C14H12F6O3 and a molecular weight of 342.24 g/mol. Its IUPAC name is [3,3,3-trifluoro-2-hydroxy-1-phenyl-2-(trifluoromethyl)propyl] 2-methylprop-2-enoate.
| Compound Name | [3,3,3-trifluoro-2-hydroxy-1-phenyl-2-(trifluoromethyl)propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 129120853 |
| Molecular Formula | C14H12F6O3 |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | [3,3,3-trifluoro-2-hydroxy-1-phenyl-2-(trifluoromethyl)propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(c1ccccc1)C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H12F6O3/c1-8(2)11(21)23-10(9-6-4-3-5-7-9)12(22,13(15,16)17)14(18,19)20/h3-7,10,22H,1H2,2H3 |
| InChIKey | WIHWHVYYHDMMLU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|