C15H20O3 — CID 145165282
(4-hydroxy-4-phenylpentan-2-yl) 2-methylprop-2-enoate (PubChem CID 145165282) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (4-hydroxy-4-phenylpentan-2-yl) 2-methylprop-2-enoate.
| Compound Name | (4-hydroxy-4-phenylpentan-2-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 145165282 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (4-hydroxy-4-phenylpentan-2-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)CC(C)(O)c1ccccc1 |
| InChI | InChI=1S/C15H20O3/c1-11(2)14(16)18-12(3)10-15(4,17)13-8-6-5-7-9-13/h5-9,12,17H,1,10H2,2-4H3 |
| InChIKey | PPBHGQBMSBDTJV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|