C15H18O6S — CID 156637950
1-[2-(benzenesulfonyl)acetyl]oxypropan-2-yl 2-methylprop-2-enoate (PubChem CID 156637950) has the molecular formula C15H18O6S and a molecular weight of 326.37 g/mol. Its IUPAC name is 1-[2-(benzenesulfonyl)acetyl]oxypropan-2-yl 2-methylprop-2-enoate.
| Compound Name | 1-[2-(benzenesulfonyl)acetyl]oxypropan-2-yl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 156637950 |
| Molecular Formula | C15H18O6S |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 1-[2-(benzenesulfonyl)acetyl]oxypropan-2-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)COC(=O)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H18O6S/c1-11(2)15(17)21-12(3)9-20-14(16)10-22(18,19)13-7-5-4-6-8-13/h4-8,12H,1,9-10H2,2-3H3 |
| InChIKey | OFIHPMQMBQPWPA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|