C29H34N2O10 — CID 88527554
1-[4-[[4-[2-(2-methylprop-2-enoyloxy)propoxycarbonyloxyamino]phenyl]methyl]anilino]oxycarbonyloxypropan-2-yl 2-methylprop-2-enoate (PubChem CID 88527554) has the molecular formula C29H34N2O10 and a molecular weight of 570.60 g/mol. Its IUPAC name is 1-[4-[[4-[2-(2-methylprop-2-enoyloxy)propoxycarbonyloxyamino]phenyl]methyl]anilino]oxycarbonyloxypropan-2-yl 2-methylprop-2-enoate.
| Compound Name | 1-[4-[[4-[2-(2-methylprop-2-enoyloxy)propoxycarbonyloxyamino]phenyl]methyl]anilino]oxycarbonyloxypropan-2-yl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88527554 |
| Molecular Formula | C29H34N2O10 |
| Molecular Weight | 570.60 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | 1-[4-[[4-[2-(2-methylprop-2-enoyloxy)propoxycarbonyloxyamino]phenyl]methyl]anilino]oxycarbonyloxypropan-2-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)COC(=O)ONc1ccc(Cc2ccc(NOC(=O)OCC(C)OC(=O)C(=C)C)cc2)cc1 |
| InChI | InChI=1S/C29H34N2O10/c1-18(2)26(32)38-20(5)16-36-28(34)40-30-24-11-7-22(8-12-24)15-23-9-13-25(14-10-23)31-41-29(35)37-17-21(6)39-27(33)19(3)4/h7-14,20-21,30-31H,1,3,15-17H2,2,4-6H3 |
| InChIKey | KXJVVCFKNPRXHA-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 147.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.60 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|