C25H28O6 — CID 22602054
1-[4-[[4-[1-(2-methylprop-2-enoyloxy)ethoxy]phenyl]methyl]phenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 22602054) has the molecular formula C25H28O6 and a molecular weight of 424.49 g/mol. Its IUPAC name is 1-[4-[[4-[1-(2-methylprop-2-enoyloxy)ethoxy]phenyl]methyl]phenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 1-[4-[[4-[1-(2-methylprop-2-enoyloxy)ethoxy]phenyl]methyl]phenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 22602054 |
| Molecular Formula | C25H28O6 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 1-[4-[[4-[1-(2-methylprop-2-enoyloxy)ethoxy]phenyl]methyl]phenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)Oc1ccc(Cc2ccc(OC(C)OC(=O)C(=C)C)cc2)cc1 |
| InChI | InChI=1S/C25H28O6/c1-16(2)24(26)30-18(5)28-22-11-7-20(8-12-22)15-21-9-13-23(14-10-21)29-19(6)31-25(27)17(3)4/h7-14,18-19H,1,3,15H2,2,4-6H3 |
| InChIKey | XZNLTBNHBSTUGZ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|